C13H18N2 — CID 91352720
6,8-dimethyl-2,3,4,5a,6,9b-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 91352720) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 6,8-dimethyl-2,3,4,5a,6,9b-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 6,8-dimethyl-2,3,4,5a,6,9b-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 91352720 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 6,8-dimethyl-2,3,4,5a,6,9b-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | CC1=CC(C)C2N=C3CCNCC3C2=C1 |
| InChI | InChI=1S/C13H18N2/c1-8-5-9(2)13-10(6-8)11-7-14-4-3-12(11)15-13/h5-6,9,11,13-14H,3-4,7H2,1-2H3 |
| InChIKey | UUECLKJZOAPCDW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |