C16H22N2 — CID 56606567
4,6-dimethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,9(16),11-triene (PubChem CID 56606567) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4,6-dimethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,9(16),11-triene.
| Compound Name | 4,6-dimethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,9(16),11-triene |
|---|---|
| PubChem CID | 56606567 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4,6-dimethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,9(16),11-triene |
| SMILES | CC1CC2=C3CCCC4=NCC(=C43)CC2C(C)N1 |
| InChI | InChI=1S/C16H22N2/c1-9-6-14-12-4-3-5-15-16(12)11(8-17-15)7-13(14)10(2)18-9/h9-10,13,18H,3-8H2,1-2H3 |
| InChIKey | KLWNIXZCNNFUBV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |