C13H18N2 — CID 58690582
3-piperidin-4-yl-5,6-dihydro-1H-isoindole (PubChem CID 58690582) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-piperidin-4-yl-5,6-dihydro-1H-isoindole.
| Compound Name | 3-piperidin-4-yl-5,6-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 58690582 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-piperidin-4-yl-5,6-dihydro-1H-isoindole |
| SMILES | C1=C2CN=C(C3CCNCC3)C2=CCC1 |
| InChI | InChI=1S/C13H18N2/c1-2-4-12-11(3-1)9-15-13(12)10-5-7-14-8-6-10/h3-4,10,14H,1-2,5-9H2 |
| InChIKey | HSNJAYOMUATLFD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |