C11H13FN2 — CID 90852966
8-fluoro-2,3,4,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 90852966) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 8-fluoro-2,3,4,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-fluoro-2,3,4,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 90852966 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 8-fluoro-2,3,4,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | FC1=CC2C(C=C1)N=C1CCNCC12 |
| InChI | InChI=1S/C11H13FN2/c12-7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-2,5,8-10,13H,3-4,6H2 |
| InChIKey | QOQZZFCPXIRZOI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |