C11H14N2 — CID 54388499
4,4a,5,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 54388499) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 4,4a,5,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 4,4a,5,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 54388499 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4,4a,5,5a,9a,9b-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | C1=CC2NC3CC=NCC3C2C=C1 |
| InChI | InChI=1S/C11H14N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,6,8-11,13H,5,7H2 |
| InChIKey | VEYLOLGNQFQJOX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |