C11H16N2 — CID 54422278
4,4a,5,5a,8,9,9a,9b-octahydro-1H-pyrido[4,3-b]indole (PubChem CID 54422278) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4,4a,5,5a,8,9,9a,9b-octahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 4,4a,5,5a,8,9,9a,9b-octahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 54422278 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4,4a,5,5a,8,9,9a,9b-octahydro-1H-pyrido[4,3-b]indole |
| SMILES | C1=CC2NC3CC=NCC3C2CC1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h2,4,6,8-11,13H,1,3,5,7H2 |
| InChIKey | WBQSWKOBKLDEJY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|