C10H12N2 — CID 91219672
1,3a,4,4a,8a,8b-hexahydropyrrolo[2,3-b]indole (PubChem CID 91219672) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,3a,4,4a,8a,8b-hexahydropyrrolo[2,3-b]indole.
| Compound Name | 1,3a,4,4a,8a,8b-hexahydropyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 91219672 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,3a,4,4a,8a,8b-hexahydropyrrolo[2,3-b]indole |
| SMILES | C1=CC2NC3N=CCC3C2C=C1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9-7(3-1)8-5-6-11-10(8)12-9/h1-4,6-10,12H,5H2 |
| InChIKey | HDFZGGZJJOUKQV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |