C11H11BrN2 — CID 123153834
3-bromo-4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indole (PubChem CID 123153834) has the molecular formula C11H11BrN2 and a molecular weight of 251.13 g/mol. Its IUPAC name is 3-bromo-4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indole.
| Compound Name | 3-bromo-4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 123153834 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-bromo-4b,8a,9,9a-tetrahydro-4aH-pyrido[2,3-b]indole |
| SMILES | BrC1=CC2C(N=C1)NC1C=CC=CC12 |
| InChI | InChI=1S/C11H11BrN2/c12-7-5-9-8-3-1-2-4-10(8)14-11(9)13-6-7/h1-6,8-11,14H |
| InChIKey | MZFLOEHFOBWDFO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |