C10H13N3 — CID 70598780
4b,5,6,8a,9,9a-hexahydro-4aH-pyrimido[4,5-b]indole (PubChem CID 70598780) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 4b,5,6,8a,9,9a-hexahydro-4aH-pyrimido[4,5-b]indole.
| Compound Name | 4b,5,6,8a,9,9a-hexahydro-4aH-pyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 70598780 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4b,5,6,8a,9,9a-hexahydro-4aH-pyrimido[4,5-b]indole |
| SMILES | C1=CC2NC3N=CN=CC3C2CC1 |
| InChI | InChI=1S/C10H13N3/c1-2-4-9-7(3-1)8-5-11-6-12-10(8)13-9/h2,4-10,13H,1,3H2 |
| InChIKey | OCVYLSGAVJHTDU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|