About 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine
1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine (PubChem CID 91550208) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine.
Analyze 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine?
The IUPAC name of 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine (CID 91550208) is 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine?
The canonical SMILES for 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine is CNCC1C=NC2C=CC=CC12.
What is the InChIKey of 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine?
The InChIKey is SKBHRAKQBTXYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-11-6-8-7-12-10-5-3-2-4-9(8)10/h2-5,7-11H,6H2,1H3.
What are the key properties of 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine?
1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine has a molecular weight of 162.24 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3a,7a-dihydro-3H-indol-3-yl)-N-methylmethanamine is sourced from PubChem (CID 91550208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).