C11H17N3 — CID 90712845
N'-(3a,7a-dihydro-3H-indol-3-ylmethyl)ethane-1,2-diamine (PubChem CID 90712845) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N'-(3a,7a-dihydro-3H-indol-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(3a,7a-dihydro-3H-indol-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 90712845 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N'-(3a,7a-dihydro-3H-indol-3-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCNCC1C=NC2C=CC=CC12 |
| InChI | InChI=1S/C11H17N3/c12-5-6-13-7-9-8-14-11-4-2-1-3-10(9)11/h1-4,8-11,13H,5-7,12H2 |
| InChIKey | VTHRVNPTLGJYGI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|