C13H19N3 — CID 123941295
3-(piperazin-1-ylmethyl)-3a,7a-dihydro-3H-indole (PubChem CID 123941295) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)-3a,7a-dihydro-3H-indole.
| Compound Name | 3-(piperazin-1-ylmethyl)-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 123941295 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)-3a,7a-dihydro-3H-indole |
| SMILES | C1=CC2N=CC(CN3CCNCC3)C2C=C1 |
| InChI | InChI=1S/C13H19N3/c1-2-4-13-12(3-1)11(9-15-13)10-16-7-5-14-6-8-16/h1-4,9,11-14H,5-8,10H2 |
| InChIKey | MZMZCSYMSVJCFK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |