C12H14N2 — CID 57108702
3,4a,4b,8a,9,9a-hexahydrocarbazol-4-imine (PubChem CID 57108702) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 3,4a,4b,8a,9,9a-hexahydrocarbazol-4-imine.
| Compound Name | 3,4a,4b,8a,9,9a-hexahydrocarbazol-4-imine |
|---|---|
| PubChem CID | 57108702 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3,4a,4b,8a,9,9a-hexahydrocarbazol-4-imine |
| SMILES | [H]/N=C1\CC=CC2NC3C=CC=CC3C12 |
| InChI | InChI=1S/C12H14N2/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-4,6-8,10-14H,5H2/b13-9+ |
| InChIKey | USZMUMNWWHPRIN-UKTHLTGXSA-N |
| XLogP | 1.66 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|