About 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine
2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine (PubChem CID 162608256) has the molecular formula C13H19F3N2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine |
| PubChem CID | 162608256 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine |
| SMILES | CC1N=C(C(F)(F)F)C=C(CC2CCNC2)C1C |
| InChI | InChI=1S/C13H19F3N2/c1-8-9(2)18-12(13(14,15)16)6-11(8)5-10-3-4-17-7-10/h6,8-10,17H,3-5,7H2,1-2H3 |
| InChIKey | NOMDGIWUAZCQCE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine?
The IUPAC name of 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine (CID 162608256) is 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine.
What is the SMILES notation for 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine?
The canonical SMILES for 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine is CC1N=C(C(F)(F)F)C=C(CC2CCNC2)C1C.
What is the InChIKey of 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine?
The InChIKey is NOMDGIWUAZCQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2/c1-8-9(2)18-12(13(14,15)16)6-11(8)5-10-3-4-17-7-10/h6,8-10,17H,3-5,7H2,1-2H3.
What are the key properties of 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine?
2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine has a molecular weight of 260.30 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-(pyrrolidin-3-ylmethyl)-6-(trifluoromethyl)-2,3-dihydropyridine is sourced from PubChem (CID 162608256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).