C12H19F2N — CID 147670972
(2R)-2-[4-(1,1-difluoroethyl)cyclohexen-1-yl]pyrrolidine (PubChem CID 147670972) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is (2R)-2-[4-(1,1-difluoroethyl)cyclohexen-1-yl]pyrrolidine.
| Compound Name | (2R)-2-[4-(1,1-difluoroethyl)cyclohexen-1-yl]pyrrolidine |
|---|---|
| PubChem CID | 147670972 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (2R)-2-[4-(1,1-difluoroethyl)cyclohexen-1-yl]pyrrolidine |
| SMILES | CC(F)(F)C1CC=C([C@H]2CCCN2)CC1 |
| InChI | InChI=1S/C12H19F2N/c1-12(13,14)10-6-4-9(5-7-10)11-3-2-8-15-11/h4,10-11,15H,2-3,5-8H2,1H3/t10?,11-/m1/s1 |
| InChIKey | GNFLKEJHHURLNG-RRKGBCIJSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|