C9H16FN — CID 89494790
(2S,4S)-4-fluoro-2-(3-methylbut-1-en-2-yl)pyrrolidine (PubChem CID 89494790) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (2S,4S)-4-fluoro-2-(3-methylbut-1-en-2-yl)pyrrolidine.
| Compound Name | (2S,4S)-4-fluoro-2-(3-methylbut-1-en-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 89494790 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (2S,4S)-4-fluoro-2-(3-methylbut-1-en-2-yl)pyrrolidine |
| SMILES | C=C(C(C)C)[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C9H16FN/c1-6(2)7(3)9-4-8(10)5-11-9/h6,8-9,11H,3-5H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | CXCLYJWYEGJJJX-IUCAKERBSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|