C11H17FN2 — CID 135135096
2-fluoro-6-methyl-4-(pyrrolidin-3-ylmethyl)-2,3-dihydropyridine (PubChem CID 135135096) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-fluoro-6-methyl-4-(pyrrolidin-3-ylmethyl)-2,3-dihydropyridine.
| Compound Name | 2-fluoro-6-methyl-4-(pyrrolidin-3-ylmethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 135135096 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2-fluoro-6-methyl-4-(pyrrolidin-3-ylmethyl)-2,3-dihydropyridine |
| SMILES | CC1=NC(F)CC(CC2CCNC2)=C1 |
| InChI | InChI=1S/C11H17FN2/c1-8-4-10(6-11(12)14-8)5-9-2-3-13-7-9/h4,9,11,13H,2-3,5-7H2,1H3 |
| InChIKey | ZTWKUTFAPFJSTA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|