C11H21FN2 — CID 143782064
(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride (PubChem CID 143782064) has the molecular formula C11H21FN2 and a molecular weight of 200.30 g/mol. Its IUPAC name is (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride.
| Compound Name | (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 143782064 |
| Molecular Formula | C11H21FN2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride |
| SMILES | CC/C(=C\C(F)=N\C)C(C)CCNC |
| InChI | InChI=1S/C11H21FN2/c1-5-10(8-11(12)14-4)9(2)6-7-13-3/h8-9,13H,5-7H2,1-4H3/b10-8+,14-11- |
| InChIKey | HHRPKOGRSGKFAV-LTBWBYIDSA-N |
| XLogP | 2.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|