(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride

C11H21FN2 — CID 143782064

IUPAC(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride
SMILESCC/C(=C\C(F)=N\C)C(C)CCNC
InChIInChI=1S/C11H21FN2/c1-5-10(8-11(12)14-4)9(2)6-7-13-3/h8-9,13H,5-7H2,1-4H3/b10-8+,14-11-
InChIKeyHHRPKOGRSGKFAV-LTBWBYIDSA-N
MW200.30 g/mol
LogP2.57
Rot. Bonds6

About (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride

(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride (PubChem CID 143782064) has the molecular formula C11H21FN2 and a molecular weight of 200.30 g/mol. Its IUPAC name is (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride.

Molecular Properties

Compound Name(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride
PubChem CID143782064
Molecular FormulaC11H21FN2
Molecular Weight200.30 g/mol
Exact Mass200.17
IUPAC Name(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride
SMILESCC/C(=C\C(F)=N\C)C(C)CCNC
InChIInChI=1S/C11H21FN2/c1-5-10(8-11(12)14-4)9(2)6-7-13-3/h8-9,13H,5-7H2,1-4H3/b10-8+,14-11-
InChIKeyHHRPKOGRSGKFAV-LTBWBYIDSA-N
XLogP2.57
TPSA24.39 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.30
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride?
The IUPAC name of (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride (CID 143782064) is (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride.
What is the SMILES notation for (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride?
The canonical SMILES for (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride is CC/C(=C\C(F)=N\C)C(C)CCNC.
What is the InChIKey of (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride?
The InChIKey is HHRPKOGRSGKFAV-LTBWBYIDSA-N. The full InChI is InChI=1S/C11H21FN2/c1-5-10(8-11(12)14-4)9(2)6-7-13-3/h8-9,13H,5-7H2,1-4H3/b10-8+,14-11-.
What are the key properties of (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride?
(E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride has a molecular weight of 200.30 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethyl-N,4-dimethyl-6-(methylamino)hex-2-enimidoyl fluoride is sourced from PubChem (CID 143782064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).