C13H28N2 — CID 123551471
2-ethyl-N-methyl-3-propylhept-3-ene-1,7-diamine (PubChem CID 123551471) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-ethyl-N-methyl-3-propylhept-3-ene-1,7-diamine.
| Compound Name | 2-ethyl-N-methyl-3-propylhept-3-ene-1,7-diamine |
|---|---|
| PubChem CID | 123551471 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-ethyl-N-methyl-3-propylhept-3-ene-1,7-diamine |
| SMILES | CCCC(=CCCCN)C(CC)CNC |
| InChI | InChI=1S/C13H28N2/c1-4-8-13(9-6-7-10-14)12(5-2)11-15-3/h9,12,15H,4-8,10-11,14H2,1-3H3 |
| InChIKey | JAZOGDTWAGHOIB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|