C11H20N2 — CID 123614076
4-ethylidene-N,5-dimethyl-5-propan-2-ylpyrrolidin-3-imine (PubChem CID 123614076) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-ethylidene-N,5-dimethyl-5-propan-2-ylpyrrolidin-3-imine.
| Compound Name | 4-ethylidene-N,5-dimethyl-5-propan-2-ylpyrrolidin-3-imine |
|---|---|
| PubChem CID | 123614076 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 4-ethylidene-N,5-dimethyl-5-propan-2-ylpyrrolidin-3-imine |
| SMILES | CC=C1/C(=N/C)CNC1(C)C(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-9-10(12-5)7-13-11(9,4)8(2)3/h6,8,13H,7H2,1-5H3/b9-6?,12-10+ |
| InChIKey | DYMFOYKKLGVCDA-GEKSPHCTSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|