C9H21N3 — CID 153331309
(Z)-4-imino-3-pyrrolidin-3-ylpent-2-en-2-amine;molecular hydrogen (PubChem CID 153331309) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is (Z)-4-imino-3-pyrrolidin-3-ylpent-2-en-2-amine;molecular hydrogen.
| Compound Name | (Z)-4-imino-3-pyrrolidin-3-ylpent-2-en-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 153331309 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | (Z)-4-imino-3-pyrrolidin-3-ylpent-2-en-2-amine;molecular hydrogen |
| SMILES | [H]/N=C(C)/C(=C(/C)N)C1CCNC1.[H][H].[H][H] |
| InChI | InChI=1S/C9H17N3.2H2/c1-6(10)9(7(2)11)8-3-4-12-5-8;;/h8,10,12H,3-5,11H2,1-2H3;2*1H/b9-7+,10-6+;; |
| InChIKey | JQUIHPBRFGMHDH-YGEHUGHFSA-N |
| XLogP | 1.36 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|