C40H62N2 — CID 91223107
8-(3-bicyclo[3.2.1]octa-1,6-dienyl)-5-(5-cyclobutyl-3-methyl-2-propylhex-4-enyl)-3-ethenyl-2-ethyl-7-methyl-4-pentan-3-yl-2,3,5,6,7,8-hexahydro-1,6-naphthyridine (PubChem CID 91223107) has the molecular formula C40H62N2 and a molecular weight of 570.95 g/mol. Its IUPAC name is 8-(3-bicyclo[3.2.1]octa-1,6-dienyl)-5-(5-cyclobutyl-3-methyl-2-propylhex-4-enyl)-3-ethenyl-2-ethyl-7-methyl-4-pentan-3-yl-2,3,5,6,7,8-hexahydro-1,6-naphthyridine.
| Compound Name | 8-(3-bicyclo[3.2.1]octa-1,6-dienyl)-5-(5-cyclobutyl-3-methyl-2-propylhex-4-enyl)-3-ethenyl-2-ethyl-7-methyl-4-pentan-3-yl-2,3,5,6,7,8-hexahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 91223107 |
| Molecular Formula | C40H62N2 |
| Molecular Weight | 570.95 g/mol |
| Exact Mass | 570.49 |
| IUPAC Name | 8-(3-bicyclo[3.2.1]octa-1,6-dienyl)-5-(5-cyclobutyl-3-methyl-2-propylhex-4-enyl)-3-ethenyl-2-ethyl-7-methyl-4-pentan-3-yl-2,3,5,6,7,8-hexahydro-1,6-naphthyridine |
| SMILES | C=CC1C(C(CC)CC)=C2C(=NC1CC)C(C1C=C3C=CC(C3)C1)C(C)NC2CC(CCC)C(C)C=C(C)C1CCC1 |
| InChI | InChI=1S/C40H62N2/c1-9-15-32(26(7)20-25(6)31-16-14-17-31)24-36-39-38(30(10-2)11-3)34(12-4)35(13-5)42-40(39)37(27(8)41-36)33-22-28-18-19-29(21-28)23-33/h12,18-20,22,26-27,29-37,41H,4,9-11,13-17,21,23-24H2,1-3,5-8H3 |
| InChIKey | YQLKNLLJRZFGNN-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.95 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|