C10H16N2 — CID 91078493
2-(1,2,3,6-tetrahydropyridin-3-yl)-2,3,4,5-tetrahydropyridine (PubChem CID 91078493) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-(1,2,3,6-tetrahydropyridin-3-yl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-(1,2,3,6-tetrahydropyridin-3-yl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 91078493 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-(1,2,3,6-tetrahydropyridin-3-yl)-2,3,4,5-tetrahydropyridine |
| SMILES | C1=CC(C2CCCC=N2)CNC1 |
| InChI | InChI=1S/C10H16N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,7,9-11H,1-2,5-6,8H2 |
| InChIKey | NQAWBTMMPRPPNX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|