C11H20N2 — CID 123641838
1-imino-N,7-dimethyl-4-methylideneoct-6-en-2-amine (PubChem CID 123641838) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-imino-N,7-dimethyl-4-methylideneoct-6-en-2-amine.
| Compound Name | 1-imino-N,7-dimethyl-4-methylideneoct-6-en-2-amine |
|---|---|
| PubChem CID | 123641838 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-imino-N,7-dimethyl-4-methylideneoct-6-en-2-amine |
| SMILES | [H]/N=C/C(CC(=C)CC=C(C)C)NC |
| InChI | InChI=1S/C11H20N2/c1-9(2)5-6-10(3)7-11(8-12)13-4/h5,8,11-13H,3,6-7H2,1-2,4H3/b12-8+ |
| InChIKey | JZPWLVIBWSABKO-XYOKQWHBSA-N |
| XLogP | 2.53 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|