C13H24N2 — CID 90968257
3-(1-iminopropan-2-ylidene)-N,4-dimethyloct-4-en-2-amine (PubChem CID 90968257) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-(1-iminopropan-2-ylidene)-N,4-dimethyloct-4-en-2-amine.
| Compound Name | 3-(1-iminopropan-2-ylidene)-N,4-dimethyloct-4-en-2-amine |
|---|---|
| PubChem CID | 90968257 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3-(1-iminopropan-2-ylidene)-N,4-dimethyloct-4-en-2-amine |
| SMILES | [H]/N=C/C(C)=C(C(C)=CCCC)C(C)NC |
| InChI | InChI=1S/C13H24N2/c1-6-7-8-10(2)13(11(3)9-14)12(4)15-5/h8-9,12,14-15H,6-7H2,1-5H3/b10-8?,13-11?,14-9+ |
| InChIKey | XYJIVZDEIPTWQO-OCDQGPFPSA-N |
| XLogP | 3.31 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|