C12H25N3 — CID 91539250
1-N-ethyl-6-imino-8-methylnon-7-ene-1,5-diamine (PubChem CID 91539250) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-N-ethyl-6-imino-8-methylnon-7-ene-1,5-diamine.
| Compound Name | 1-N-ethyl-6-imino-8-methylnon-7-ene-1,5-diamine |
|---|---|
| PubChem CID | 91539250 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-N-ethyl-6-imino-8-methylnon-7-ene-1,5-diamine |
| SMILES | [H]/N=C(\C=C(C)C)C(N)CCCCNCC |
| InChI | InChI=1S/C12H25N3/c1-4-15-8-6-5-7-11(13)12(14)9-10(2)3/h9,11,14-15H,4-8,13H2,1-3H3/b14-12+ |
| InChIKey | DVYPQUDEDMJQPI-WYMLVPIESA-N |
| XLogP | 2.08 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|