C11H21N3 — CID 123522911
5-[2-(ethylamino)ethylimino]-3-methylcyclohex-3-en-1-amine (PubChem CID 123522911) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethylimino]-3-methylcyclohex-3-en-1-amine.
| Compound Name | 5-[2-(ethylamino)ethylimino]-3-methylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 123522911 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 5-[2-(ethylamino)ethylimino]-3-methylcyclohex-3-en-1-amine |
| SMILES | CCNCC/N=C1\C=C(C)CC(N)C1 |
| InChI | InChI=1S/C11H21N3/c1-3-13-4-5-14-11-7-9(2)6-10(12)8-11/h7,10,13H,3-6,8,12H2,1-2H3/b14-11+ |
| InChIKey | LVUXNYFFYXURJR-SDNWHVSQSA-N |
| XLogP | 1.10 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|