C14H24N2 — CID 123499287
1-(2,3-dihydropyridin-6-yl)-5-methyloct-4-en-1-amine (PubChem CID 123499287) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(2,3-dihydropyridin-6-yl)-5-methyloct-4-en-1-amine.
| Compound Name | 1-(2,3-dihydropyridin-6-yl)-5-methyloct-4-en-1-amine |
|---|---|
| PubChem CID | 123499287 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-(2,3-dihydropyridin-6-yl)-5-methyloct-4-en-1-amine |
| SMILES | CCCC(C)=CCCC(N)C1=NCCC=C1 |
| InChI | InChI=1S/C14H24N2/c1-3-7-12(2)8-6-9-13(15)14-10-4-5-11-16-14/h4,8,10,13H,3,5-7,9,11,15H2,1-2H3 |
| InChIKey | IMQYACKGEBPZFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|