C10H14N2 — CID 57182520
3,5,8,8a-tetrahydroquinolin-2-ylmethanamine (PubChem CID 57182520) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3,5,8,8a-tetrahydroquinolin-2-ylmethanamine.
| Compound Name | 3,5,8,8a-tetrahydroquinolin-2-ylmethanamine |
|---|---|
| PubChem CID | 57182520 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3,5,8,8a-tetrahydroquinolin-2-ylmethanamine |
| SMILES | NCC1=NC2CC=CCC2=CC1 |
| InChI | InChI=1S/C10H14N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-2,5,10H,3-4,6-7,11H2 |
| InChIKey | ZZKWFCBKYPQYHM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|