C9H14N2 — CID 142260711
2,3,5,6,7,8-hexahydroquinolin-8-amine (PubChem CID 142260711) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydroquinolin-8-amine.
| Compound Name | 2,3,5,6,7,8-hexahydroquinolin-8-amine |
|---|---|
| PubChem CID | 142260711 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,3,5,6,7,8-hexahydroquinolin-8-amine |
| SMILES | NC1CCCC2=CCCN=C21 |
| InChI | InChI=1S/C9H14N2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h4,8H,1-3,5-6,10H2 |
| InChIKey | AITWMBMRFWBBSM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |