About cyclohexanamine;cyclohex-2-en-1-imine
cyclohexanamine;cyclohex-2-en-1-imine (PubChem CID 158008315) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is cyclohexanamine;cyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | cyclohexanamine;cyclohex-2-en-1-imine |
| PubChem CID | 158008315 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | cyclohexanamine;cyclohex-2-en-1-imine |
| SMILES | NC1CCCCC1.[H]/N=C1/C=CCCC1 |
| InChI | InChI=1S/C6H13N.C6H9N/c2*7-6-4-2-1-3-5-6/h6H,1-5,7H2;2,4,7H,1,3,5H2/b;7-6- |
| InChIKey | FEOOIIJSWHKSMU-VDXOJYAPSA-N |
| XLogP | 3.02 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;cyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;cyclohex-2-en-1-imine?
The IUPAC name of cyclohexanamine;cyclohex-2-en-1-imine (CID 158008315) is cyclohexanamine;cyclohex-2-en-1-imine.
What is the SMILES notation for cyclohexanamine;cyclohex-2-en-1-imine?
The canonical SMILES for cyclohexanamine;cyclohex-2-en-1-imine is NC1CCCCC1.[H]/N=C1/C=CCCC1.
What is the InChIKey of cyclohexanamine;cyclohex-2-en-1-imine?
The InChIKey is FEOOIIJSWHKSMU-VDXOJYAPSA-N. The full InChI is InChI=1S/C6H13N.C6H9N/c2*7-6-4-2-1-3-5-6/h6H,1-5,7H2;2,4,7H,1,3,5H2/b;7-6-.
What are the key properties of cyclohexanamine;cyclohex-2-en-1-imine?
cyclohexanamine;cyclohex-2-en-1-imine has a molecular weight of 194.32 g/mol, XLogP of 3.02, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;cyclohex-2-en-1-imine is sourced from PubChem (CID 158008315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).