C10H16N2 — CID 163951187
(1S,3Z)-2-imino-3-(2-methylprop-2-enylidene)cyclohexan-1-amine (PubChem CID 163951187) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,3Z)-2-imino-3-(2-methylprop-2-enylidene)cyclohexan-1-amine.
| Compound Name | (1S,3Z)-2-imino-3-(2-methylprop-2-enylidene)cyclohexan-1-amine |
|---|---|
| PubChem CID | 163951187 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1S,3Z)-2-imino-3-(2-methylprop-2-enylidene)cyclohexan-1-amine |
| SMILES | [H]/N=C1C(=C\C(=C)C)/CCC[C@@H]/1N |
| InChI | InChI=1S/C10H16N2/c1-7(2)6-8-4-3-5-9(11)10(8)12/h6,9,12H,1,3-5,11H2,2H3/b8-6-,12-10-/t9-/m0/s1 |
| InChIKey | RZLNLRIASUTXAR-MRGRHJOHSA-N |
| XLogP | 2.02 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|