C10H19N3 — CID 142119048
(3E,5Z)-7-imino-3-methylnona-3,5-diene-1,9-diamine (PubChem CID 142119048) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (3E,5Z)-7-imino-3-methylnona-3,5-diene-1,9-diamine.
| Compound Name | (3E,5Z)-7-imino-3-methylnona-3,5-diene-1,9-diamine |
|---|---|
| PubChem CID | 142119048 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (3E,5Z)-7-imino-3-methylnona-3,5-diene-1,9-diamine |
| SMILES | [H]/N=C(/C=C\C=C(/C)CCN)CCN |
| InChI | InChI=1S/C10H19N3/c1-9(5-7-11)3-2-4-10(13)6-8-12/h2-4,13H,5-8,11-12H2,1H3/b4-2-,9-3+,13-10- |
| InChIKey | XVTRJHSBKBGHCN-JPTYCKRWSA-N |
| XLogP | 1.21 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|