C9H16N2 — CID 90857903
8-iminonona-3,5-dien-2-amine (PubChem CID 90857903) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 8-iminonona-3,5-dien-2-amine.
| Compound Name | 8-iminonona-3,5-dien-2-amine |
|---|---|
| PubChem CID | 90857903 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 8-iminonona-3,5-dien-2-amine |
| SMILES | [H]/N=C(\C)CC=CC=CC(C)N |
| InChI | InChI=1S/C9H16N2/c1-8(10)6-4-3-5-7-9(2)11/h3-6,8,11H,7,10H2,1-2H3/b5-3?,6-4?,11-9+ |
| InChIKey | KUDXAJRHOZGHBU-UBYCCQIKSA-N |
| XLogP | 1.88 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|