C8H11N3 — CID 142433052
1-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethanamine (PubChem CID 142433052) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethanamine.
| Compound Name | 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 142433052 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethanamine |
| SMILES | [H]/N=C1\C=CC(C(C)N)=C\C1=N/[H] |
| InChI | InChI=1S/C8H11N3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-5,10-11H,9H2,1H3/b10-7+,11-8+ |
| InChIKey | IMRKZRLMTUIOCR-AMMQDNIMSA-N |
| XLogP | 0.87 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|