C7H8N2S — CID 59715876
7-methyl-1,7a-dihydro-2,1,3-benzothiadiazole (PubChem CID 59715876) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 7-methyl-1,7a-dihydro-2,1,3-benzothiadiazole.
| Compound Name | 7-methyl-1,7a-dihydro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 59715876 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 7-methyl-1,7a-dihydro-2,1,3-benzothiadiazole |
| SMILES | CC1=CC=CC2=NSNC12 |
| InChI | InChI=1S/C7H8N2S/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4,7,9H,1H3 |
| InChIKey | JMWSHAHMYARTCC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|