C9H14N2 — CID 91298887
1-cyclohexa-1,5-dien-1-yl-2-iminopropan-1-amine (PubChem CID 91298887) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-iminopropan-1-amine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-iminopropan-1-amine |
|---|---|
| PubChem CID | 91298887 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-iminopropan-1-amine |
| SMILES | [H]/N=C(\C)C(N)C1=CCCC=C1 |
| InChI | InChI=1S/C9H14N2/c1-7(10)9(11)8-5-3-2-4-6-8/h3,5-6,9-10H,2,4,11H2,1H3/b10-7+ |
| InChIKey | SCJMLFRZLDAEBG-JXMROGBWSA-N |
| XLogP | 1.63 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|