C8H11N3 — CID 18183674
4-diazo-2,3-dimethylcyclohexa-2,5-dien-1-amine (PubChem CID 18183674) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 4-diazo-2,3-dimethylcyclohexa-2,5-dien-1-amine.
| Compound Name | 4-diazo-2,3-dimethylcyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 18183674 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 4-diazo-2,3-dimethylcyclohexa-2,5-dien-1-amine |
| SMILES | CC1=C(C)C(N)C=CC1=[N+]=[N-] |
| InChI | InChI=1S/C8H11N3/c1-5-6(2)8(11-10)4-3-7(5)9/h3-4,7H,9H2,1-2H3 |
| InChIKey | LFKNIKQDTFBSSE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|