C9H12N2 — CID 90810515
3,5,8,8a-tetrahydroquinolin-5-amine (PubChem CID 90810515) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 3,5,8,8a-tetrahydroquinolin-5-amine.
| Compound Name | 3,5,8,8a-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 90810515 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3,5,8,8a-tetrahydroquinolin-5-amine |
| SMILES | NC1C=CCC2N=CCC=C12 |
| InChI | InChI=1S/C9H12N2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,3-4,6,8-9H,2,5,10H2 |
| InChIKey | WUQVTWQBZRLQAY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|