C20H38N2 — CID 123797413
N,4,9-trimethyl-N-(4-methyl-5-methyliminopentan-2-yl)deca-3,5-dien-1-amine (PubChem CID 123797413) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N,4,9-trimethyl-N-(4-methyl-5-methyliminopentan-2-yl)deca-3,5-dien-1-amine.
| Compound Name | N,4,9-trimethyl-N-(4-methyl-5-methyliminopentan-2-yl)deca-3,5-dien-1-amine |
|---|---|
| PubChem CID | 123797413 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N,4,9-trimethyl-N-(4-methyl-5-methyliminopentan-2-yl)deca-3,5-dien-1-amine |
| SMILES | C/N=C/C(C)CC(C)N(C)CCC=C(C)C=CCCC(C)C |
| InChI | InChI=1S/C20H38N2/c1-17(2)11-8-9-12-18(3)13-10-14-22(7)20(5)15-19(4)16-21-6/h9,12-13,16-17,19-20H,8,10-11,14-15H2,1-7H3/b12-9?,18-13?,21-16+ |
| InChIKey | VFSMDJJISJXCNB-KASGWNQCSA-N |
| XLogP | 5.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|