C13H26N2 — CID 123357012
N,N,4-trimethyl-1-pent-3-enyliminopentan-3-amine (PubChem CID 123357012) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N,N,4-trimethyl-1-pent-3-enyliminopentan-3-amine.
| Compound Name | N,N,4-trimethyl-1-pent-3-enyliminopentan-3-amine |
|---|---|
| PubChem CID | 123357012 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N,N,4-trimethyl-1-pent-3-enyliminopentan-3-amine |
| SMILES | CC=CCC/N=C/CC(C(C)C)N(C)C |
| InChI | InChI=1S/C13H26N2/c1-6-7-8-10-14-11-9-13(12(2)3)15(4)5/h6-7,11-13H,8-10H2,1-5H3/b7-6?,14-11+ |
| InChIKey | CBCXUVZFGPGZOP-QEACRHRISA-N |
| XLogP | 3.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|