C13H22N+ — CID 123271073
1,3,7-trimethyl-1-azoniacycloundeca-4,8,11-triene (PubChem CID 123271073) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is 1,3,7-trimethyl-1-azoniacycloundeca-4,8,11-triene.
| Compound Name | 1,3,7-trimethyl-1-azoniacycloundeca-4,8,11-triene |
|---|---|
| PubChem CID | 123271073 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | 1,3,7-trimethyl-1-azoniacycloundeca-4,8,11-triene |
| SMILES | CC1C=CC/C=[N+](/C)CC(C)C=CC1 |
| InChI | InChI=1S/C13H22N/c1-12-7-4-5-10-14(3)11-13(2)9-6-8-12/h4,6-7,9-10,12-13H,5,8,11H2,1-3H3/q+1/b7-4?,9-6?,14-10- |
| InChIKey | YFIWFKZGYLRLEG-ADQHCYQNSA-N |
| XLogP | 2.88 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|