C11H20N+ — CID 123155771
5,6-dimethylhepta-2,5-dienylidene(dimethyl)azanium (PubChem CID 123155771) has the molecular formula C11H20N+ and a molecular weight of 166.29 g/mol. Its IUPAC name is 5,6-dimethylhepta-2,5-dienylidene(dimethyl)azanium.
| Compound Name | 5,6-dimethylhepta-2,5-dienylidene(dimethyl)azanium |
|---|---|
| PubChem CID | 123155771 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | 5,6-dimethylhepta-2,5-dienylidene(dimethyl)azanium |
| SMILES | CC(C)=C(C)CC=CC=[N+](C)C |
| InChI | InChI=1S/C11H20N/c1-10(2)11(3)8-6-7-9-12(4)5/h6-7,9H,8H2,1-5H3/q+1 |
| InChIKey | QVMUMSNYVJANHE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|