C11H16N+ — CID 58850616
(10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium (PubChem CID 58850616) has the molecular formula C11H16N+ and a molecular weight of 162.26 g/mol. Its IUPAC name is (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium.
| Compound Name | (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 58850616 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium |
| SMILES | C[C@@]12C=CCC[N+]1=CCC=CC2 |
| InChI | InChI=1S/C11H16N/c1-11-7-3-2-5-9-12(11)10-6-4-8-11/h2-4,8-9H,5-7,10H2,1H3/q+1/t11-/m1/s1 |
| InChIKey | HNRAREQRQYLADS-LLVKDONJSA-N |
| XLogP | 2.14 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|