C14H31N2+ — CID 161170921
(10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium;azane;methane (PubChem CID 161170921) has the molecular formula C14H31N2+ and a molecular weight of 227.42 g/mol. Its IUPAC name is (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium;azane;methane.
| Compound Name | (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium;azane;methane |
|---|---|
| PubChem CID | 161170921 |
| Molecular Formula | C14H31N2+ |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.25 |
| IUPAC Name | (10aR)-10a-methyl-3,4,7,10-tetrahydropyrido[1,2-a]azepin-5-ium;azane;methane |
| SMILES | C.C.C.C[C@@]12C=CCC[N+]1=CCC=CC2.N |
| InChI | InChI=1S/C11H16N.3CH4.H3N/c1-11-7-3-2-5-9-12(11)10-6-4-8-11;;;;/h2-4,8-9H,5-7,10H2,1H3;3*1H4;1H3/q+1;;;;/t11-;;;;/m1..../s1 |
| InChIKey | GLGUUMIDZQMFTA-LOSFGHDGSA-N |
| XLogP | 4.21 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|