C14H28N+ — CID 10354529
[(E)-hex-2-enyl]-(2-methylpropyl)-(2-methylpropylidene)azanium (PubChem CID 10354529) has the molecular formula C14H28N+ and a molecular weight of 210.38 g/mol. Its IUPAC name is [(E)-hex-2-enyl]-(2-methylpropyl)-(2-methylpropylidene)azanium.
| Compound Name | [(E)-hex-2-enyl]-(2-methylpropyl)-(2-methylpropylidene)azanium |
|---|---|
| PubChem CID | 10354529 |
| Molecular Formula | C14H28N+ |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | [(E)-hex-2-enyl]-(2-methylpropyl)-(2-methylpropylidene)azanium |
| SMILES | CCC/C=C/C/[N+](=C\C(C)C)CC(C)C |
| InChI | InChI=1S/C14H28N/c1-6-7-8-9-10-15(11-13(2)3)12-14(4)5/h8-9,11,13-14H,6-7,10,12H2,1-5H3/q+1/b9-8+,15-11+ |
| InChIKey | PPUPSXRKTNRACG-QCTDOKRBSA-N |
| XLogP | 3.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|