C13H22N+ — CID 123231309
ethyl-methyl-(2-methyl-6-methylideneocta-4,7-dienylidene)azanium (PubChem CID 123231309) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is ethyl-methyl-(2-methyl-6-methylideneocta-4,7-dienylidene)azanium.
| Compound Name | ethyl-methyl-(2-methyl-6-methylideneocta-4,7-dienylidene)azanium |
|---|---|
| PubChem CID | 123231309 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | ethyl-methyl-(2-methyl-6-methylideneocta-4,7-dienylidene)azanium |
| SMILES | C=CC(=C)C=CCC(C)/C=[N+](\C)CC |
| InChI | InChI=1S/C13H22N/c1-6-12(3)9-8-10-13(4)11-14(5)7-2/h6,8-9,11,13H,1,3,7,10H2,2,4-5H3/q+1/b9-8?,14-11+ |
| InChIKey | ZOFJAHRKDHLFNJ-PDJANDPOSA-N |
| XLogP | 3.04 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|