C12H21N — CID 88562301
(Z,2E)-N,6-dimethyl-2-propylidenehept-3-en-1-imine (PubChem CID 88562301) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (Z,2E)-N,6-dimethyl-2-propylidenehept-3-en-1-imine.
| Compound Name | (Z,2E)-N,6-dimethyl-2-propylidenehept-3-en-1-imine |
|---|---|
| PubChem CID | 88562301 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (Z,2E)-N,6-dimethyl-2-propylidenehept-3-en-1-imine |
| SMILES | CC/C=C(\C=C/CC(C)C)/C=N/C |
| InChI | InChI=1S/C12H21N/c1-5-7-12(10-13-4)9-6-8-11(2)3/h6-7,9-11H,5,8H2,1-4H3/b9-6-,12-7+,13-10+ |
| InChIKey | KZVLKKMOLNYQCE-XGHVHIKJSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|