C19H34N+ — CID 162436503
[(3E,5E,7E)-2-ethyl-3-methyldodeca-3,5,7-trienyl]-methyl-propylideneazanium (PubChem CID 162436503) has the molecular formula C19H34N+ and a molecular weight of 276.49 g/mol. Its IUPAC name is [(3E,5E,7E)-2-ethyl-3-methyldodeca-3,5,7-trienyl]-methyl-propylideneazanium.
| Compound Name | [(3E,5E,7E)-2-ethyl-3-methyldodeca-3,5,7-trienyl]-methyl-propylideneazanium |
|---|---|
| PubChem CID | 162436503 |
| Molecular Formula | C19H34N+ |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.27 |
| IUPAC Name | [(3E,5E,7E)-2-ethyl-3-methyldodeca-3,5,7-trienyl]-methyl-propylideneazanium |
| SMILES | CC/C=[N+](\C)CC(CC)/C(C)=C/C=C/C=C/CCCC |
| InChI | InChI=1S/C19H34N/c1-6-9-10-11-12-13-14-15-18(4)19(8-3)17-20(5)16-7-2/h11-16,19H,6-10,17H2,1-5H3/q+1/b12-11+,14-13+,18-15+,20-16+ |
| InChIKey | SOPOZMASUNVLCA-IQFVDJMESA-N |
| XLogP | 5.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|