C19H35N — CID 130183025
N-[(Z,2E)-5-methyl-2-pentylideneoct-3-enyl]pentan-1-imine (PubChem CID 130183025) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is N-[(Z,2E)-5-methyl-2-pentylideneoct-3-enyl]pentan-1-imine.
| Compound Name | N-[(Z,2E)-5-methyl-2-pentylideneoct-3-enyl]pentan-1-imine |
|---|---|
| PubChem CID | 130183025 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | N-[(Z,2E)-5-methyl-2-pentylideneoct-3-enyl]pentan-1-imine |
| SMILES | CCCC/C=N/CC(/C=C\C(C)CCC)=C/CCCC |
| InChI | InChI=1S/C19H35N/c1-5-8-10-13-19(15-14-18(4)12-7-3)17-20-16-11-9-6-2/h13-16,18H,5-12,17H2,1-4H3/b15-14-,19-13+,20-16+ |
| InChIKey | SAGABZNDNMRQGQ-VDPUAEDKSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|